C17H21ClN4O4 — CID 144555654
8-chloro-10-[(3S)-3,5-dihydroxypentyl]benzo[g]pteridine-2,4-dione;ethane (PubChem CID 144555654) has the molecular formula C17H21ClN4O4 and a molecular weight of 380.83 g/mol. Its IUPAC name is 8-chloro-10-[(3S)-3,5-dihydroxypentyl]benzo[g]pteridine-2,4-dione;ethane.
| Compound Name | 8-chloro-10-[(3S)-3,5-dihydroxypentyl]benzo[g]pteridine-2,4-dione;ethane |
|---|---|
| PubChem CID | 144555654 |
| Molecular Formula | C17H21ClN4O4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 8-chloro-10-[(3S)-3,5-dihydroxypentyl]benzo[g]pteridine-2,4-dione;ethane |
| SMILES | CC.O=c1nc2n(CC[C@H](O)CCO)c3cc(Cl)ccc3nc-2c(=O)[nH]1 |
| InChI | InChI=1S/C15H15ClN4O4.C2H6/c16-8-1-2-10-11(7-8)20(5-3-9(22)4-6-21)13-12(17-10)14(23)19-15(24)18-13;1-2/h1-2,7,9,21-22H,3-6H2,(H,19,23,24);1-2H3/t9-;/m0./s1 |
| InChIKey | CYZJYPAUPVFKHF-FVGYRXGTSA-N |
| XLogP | 1.40 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|