C19H24N6O5 — CID 143941639
N-[2-[[10-[(3S)-3,5-dihydroxypentyl]-7-methyl-2,4-dioxobenzo[g]pteridin-8-yl]amino]ethyl]formamide (PubChem CID 143941639) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-[2-[[10-[(3S)-3,5-dihydroxypentyl]-7-methyl-2,4-dioxobenzo[g]pteridin-8-yl]amino]ethyl]formamide.
| Compound Name | N-[2-[[10-[(3S)-3,5-dihydroxypentyl]-7-methyl-2,4-dioxobenzo[g]pteridin-8-yl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 143941639 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[2-[[10-[(3S)-3,5-dihydroxypentyl]-7-methyl-2,4-dioxobenzo[g]pteridin-8-yl]amino]ethyl]formamide |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC[C@H](O)CCO)c2cc1NCCNC=O |
| InChI | InChI=1S/C19H24N6O5/c1-11-8-14-15(9-13(11)21-5-4-20-10-27)25(6-2-12(28)3-7-26)17-16(22-14)18(29)24-19(30)23-17/h8-10,12,21,26,28H,2-7H2,1H3,(H,20,27)(H,24,29,30)/t12-/m0/s1 |
| InChIKey | DRSOOXKYZMPSNI-LBPRGKRZSA-N |
| XLogP | -0.82 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|