C19H24N4O6 — CID 144555632
12-[(3S)-3,5-dihydroxypentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione;ethane (PubChem CID 144555632) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 12-[(3S)-3,5-dihydroxypentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione;ethane.
| Compound Name | 12-[(3S)-3,5-dihydroxypentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione;ethane |
|---|---|
| PubChem CID | 144555632 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 12-[(3S)-3,5-dihydroxypentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione;ethane |
| SMILES | CC.O=c1nc2n(CC[C@H](O)CCO)c3cc4c(cc3nc-2c(=O)[nH]1)OCCO4 |
| InChI | InChI=1S/C17H18N4O6.C2H6/c22-4-2-9(23)1-3-21-11-8-13-12(26-5-6-27-13)7-10(11)18-14-15(21)19-17(25)20-16(14)24;1-2/h7-9,22-23H,1-6H2,(H,20,24,25);1-2H3/t9-;/m0./s1 |
| InChIKey | SRFRRJQYVQXXKI-FVGYRXGTSA-N |
| XLogP | 0.52 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|