C17H18ClN5O4 — CID 166558310
2-(7-chloro-8-ethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl N-ethylcarbamate (PubChem CID 166558310) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is 2-(7-chloro-8-ethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl N-ethylcarbamate.
| Compound Name | 2-(7-chloro-8-ethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 166558310 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-(7-chloro-8-ethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(Cl)c(CC)cc21 |
| InChI | InChI=1S/C17H18ClN5O4/c1-3-9-7-12-11(8-10(9)18)20-13-14(21-16(25)22-15(13)24)23(12)5-6-27-17(26)19-4-2/h7-8H,3-6H2,1-2H3,(H,19,26)(H,22,24,25) |
| InChIKey | HQAKOINFPJZEDF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|