C20H26N4O6 — CID 91307659
8-ethyl-7-propyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione (PubChem CID 91307659) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 8-ethyl-7-propyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione.
| Compound Name | 8-ethyl-7-propyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91307659 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 8-ethyl-7-propyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione |
| SMILES | CCCc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)CO)c2cc1CC |
| InChI | InChI=1S/C20H26N4O6/c1-3-5-11-6-12-13(7-10(11)4-2)24(8-14(26)17(28)15(27)9-25)18-16(21-12)19(29)23-20(30)22-18/h6-7,14-15,17,25-28H,3-5,8-9H2,1-2H3,(H,23,29,30) |
| InChIKey | JEWCAOTWGRCECS-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|