C21H28N6O6 — CID 46174923
7-methyl-8-(4-methylpiperazin-1-yl)-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione (PubChem CID 46174923) has the molecular formula C21H28N6O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 7-methyl-8-(4-methylpiperazin-1-yl)-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione.
| Compound Name | 7-methyl-8-(4-methylpiperazin-1-yl)-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 46174923 |
| Molecular Formula | C21H28N6O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 7-methyl-8-(4-methylpiperazin-1-yl)-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C21H28N6O6/c1-11-7-12-14(8-13(11)26-5-3-25(2)4-6-26)27(9-15(29)18(31)16(30)10-28)19-17(22-12)20(32)24-21(33)23-19/h7-8,15-16,18,28-31H,3-6,9-10H2,1-2H3,(H,24,32,33)/t15-,16+,18-/m0/s1 |
| InChIKey | RUQCASCXLKGVGJ-JZXOWHBKSA-N |
| XLogP | -2.28 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|