C19H21N6O2+ — CID 91384401
[10-(4-cyanobutyl)-7-ethyl-2,4-dioxobenzo[g]pteridin-8-yl]-methyl-methylideneazanium (PubChem CID 91384401) has the molecular formula C19H21N6O2+ and a molecular weight of 365.42 g/mol. Its IUPAC name is [10-(4-cyanobutyl)-7-ethyl-2,4-dioxobenzo[g]pteridin-8-yl]-methyl-methylideneazanium.
| Compound Name | [10-(4-cyanobutyl)-7-ethyl-2,4-dioxobenzo[g]pteridin-8-yl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 91384401 |
| Molecular Formula | C19H21N6O2+ |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [10-(4-cyanobutyl)-7-ethyl-2,4-dioxobenzo[g]pteridin-8-yl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)c1cc2c(cc1CC)nc1c(=O)[nH]c(=O)nc-1n2CCCCC#N |
| InChI | InChI=1S/C19H20N6O2/c1-4-12-10-13-15(11-14(12)24(2)3)25(9-7-5-6-8-20)17-16(21-13)18(26)23-19(27)22-17/h10-11H,2,4-7,9H2,1,3H3/p+1 |
| InChIKey | JWJPOIALTXUHFV-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|