C12H20N2O2S — CID 62592463
N'-(4-ethylsulfonylphenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 62592463) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N'-(4-ethylsulfonylphenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-(4-ethylsulfonylphenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62592463 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N'-(4-ethylsulfonylphenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCS(=O)(=O)c1ccc(N(C)CCNC)cc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-4-17(15,16)12-7-5-11(6-8-12)14(3)10-9-13-2/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | HAMDOJVGNGAJSI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |