C14H24N2O2S — CID 62591786
N'-(4-ethylsulfonylphenyl)-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 62591786) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is N'-(4-ethylsulfonylphenyl)-N'-methyl-N-propylethane-1,2-diamine.
| Compound Name | N'-(4-ethylsulfonylphenyl)-N'-methyl-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 62591786 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N'-(4-ethylsulfonylphenyl)-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-4-10-15-11-12-16(3)13-6-8-14(9-7-13)19(17,18)5-2/h6-9,15H,4-5,10-12H2,1-3H3 |
| InChIKey | VSEFJKHVDAIYQF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|