C12H19FN2O2S — CID 62555231
N'-(4-fluorophenyl)-N'-methyl-N-(2-methylsulfonylethyl)ethane-1,2-diamine (PubChem CID 62555231) has the molecular formula C12H19FN2O2S and a molecular weight of 274.36 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N'-methyl-N-(2-methylsulfonylethyl)ethane-1,2-diamine.
| Compound Name | N'-(4-fluorophenyl)-N'-methyl-N-(2-methylsulfonylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62555231 |
| Molecular Formula | C12H19FN2O2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N'-(4-fluorophenyl)-N'-methyl-N-(2-methylsulfonylethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCCS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H19FN2O2S/c1-15(12-5-3-11(13)4-6-12)9-7-14-8-10-18(2,16)17/h3-6,14H,7-10H2,1-2H3 |
| InChIKey | CCFZBENRAAKWAN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|