C15H25FN2O — CID 62555568
N-(2-butoxyethyl)-N'-(4-fluorophenyl)-N'-methylethane-1,2-diamine (PubChem CID 62555568) has the molecular formula C15H25FN2O and a molecular weight of 268.38 g/mol. Its IUPAC name is N-(2-butoxyethyl)-N'-(4-fluorophenyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-(2-butoxyethyl)-N'-(4-fluorophenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62555568 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N-(2-butoxyethyl)-N'-(4-fluorophenyl)-N'-methylethane-1,2-diamine |
| SMILES | CCCCOCCNCCN(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H25FN2O/c1-3-4-12-19-13-10-17-9-11-18(2)15-7-5-14(16)6-8-15/h5-8,17H,3-4,9-13H2,1-2H3 |
| InChIKey | YITIYOLWAKZACO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|