C24H40O4 — CID 625939
methyl 3-(3-hydroxy-3a,6-dimethyl-7-oxo-8-pentyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl)propanoate (PubChem CID 625939) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-3a,6-dimethyl-7-oxo-8-pentyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl)propanoate.
| Compound Name | methyl 3-(3-hydroxy-3a,6-dimethyl-7-oxo-8-pentyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl)propanoate |
|---|---|
| PubChem CID | 625939 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | methyl 3-(3-hydroxy-3a,6-dimethyl-7-oxo-8-pentyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl)propanoate |
| SMILES | CCCCCC1CC2C(CCC3(C)C(O)CCC23)C(C)(CCC(=O)OC)C1=O |
| InChI | InChI=1S/C24H40O4/c1-5-6-7-8-16-15-17-18-9-10-20(25)23(18,2)13-11-19(17)24(3,22(16)27)14-12-21(26)28-4/h16-20,25H,5-15H2,1-4H3 |
| InChIKey | NQTLCHIWCUILIA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|