C14H29NO3S — CID 62597813
N-(2-methylsulfonylethyl)-2-(3,3,5-trimethylcyclohexyl)oxyethanamine (PubChem CID 62597813) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N-(2-methylsulfonylethyl)-2-(3,3,5-trimethylcyclohexyl)oxyethanamine.
| Compound Name | N-(2-methylsulfonylethyl)-2-(3,3,5-trimethylcyclohexyl)oxyethanamine |
|---|---|
| PubChem CID | 62597813 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-(2-methylsulfonylethyl)-2-(3,3,5-trimethylcyclohexyl)oxyethanamine |
| SMILES | CC1CC(OCCNCCS(C)(=O)=O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H29NO3S/c1-12-9-13(11-14(2,3)10-12)18-7-5-15-6-8-19(4,16)17/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | COBLWHASQXFJJU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|