C12H20N2 — CID 62604870
N-methyl-1-(3-methyl-2-pyridinyl)pentan-1-amine (PubChem CID 62604870) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-2-pyridinyl)pentan-1-amine.
| Compound Name | N-methyl-1-(3-methyl-2-pyridinyl)pentan-1-amine |
|---|---|
| PubChem CID | 62604870 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-methyl-1-(3-methyl-2-pyridinyl)pentan-1-amine |
| SMILES | CCCCC(NC)c1ncccc1C |
| InChI | InChI=1S/C12H20N2/c1-4-5-8-11(13-3)12-10(2)7-6-9-14-12/h6-7,9,11,13H,4-5,8H2,1-3H3 |
| InChIKey | ZKAHZAAUHPXZTE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |