C17H20BrFN2 — CID 62605292
1-(2-bromo-5-fluorophenyl)-N-propyl-3-pyridin-4-ylpropan-2-amine (PubChem CID 62605292) has the molecular formula C17H20BrFN2 and a molecular weight of 351.26 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-N-propyl-3-pyridin-4-ylpropan-2-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-N-propyl-3-pyridin-4-ylpropan-2-amine |
|---|---|
| PubChem CID | 62605292 |
| Molecular Formula | C17H20BrFN2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-N-propyl-3-pyridin-4-ylpropan-2-amine |
| SMILES | CCCNC(Cc1ccncc1)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C17H20BrFN2/c1-2-7-21-16(10-13-5-8-20-9-6-13)12-14-11-15(19)3-4-17(14)18/h3-6,8-9,11,16,21H,2,7,10,12H2,1H3 |
| InChIKey | KGILZCQMLUQYNP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |