C16H33NO3 — CID 62610112
4-tert-butyl-2-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]cyclohexan-1-ol (PubChem CID 62610112) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is 4-tert-butyl-2-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-2-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 62610112 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | 4-tert-butyl-2-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]cyclohexan-1-ol |
| SMILES | COCC(O)CN(C)CC1CC(C(C)(C)C)CCC1O |
| InChI | InChI=1S/C16H33NO3/c1-16(2,3)13-6-7-15(19)12(8-13)9-17(4)10-14(18)11-20-5/h12-15,18-19H,6-11H2,1-5H3 |
| InChIKey | WPCRFFRSECMPBS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |