C18H37NO2 — CID 62610969
2-[[butan-2-yl(2-methoxyethyl)amino]methyl]-4-tert-butylcyclohexan-1-ol (PubChem CID 62610969) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-[[butan-2-yl(2-methoxyethyl)amino]methyl]-4-tert-butylcyclohexan-1-ol.
| Compound Name | 2-[[butan-2-yl(2-methoxyethyl)amino]methyl]-4-tert-butylcyclohexan-1-ol |
|---|---|
| PubChem CID | 62610969 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 2-[[butan-2-yl(2-methoxyethyl)amino]methyl]-4-tert-butylcyclohexan-1-ol |
| SMILES | CCC(C)N(CCOC)CC1CC(C(C)(C)C)CCC1O |
| InChI | InChI=1S/C18H37NO2/c1-7-14(2)19(10-11-21-6)13-15-12-16(18(3,4)5)8-9-17(15)20/h14-17,20H,7-13H2,1-6H3 |
| InChIKey | RTYCGPXMTZKXBZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |