C17H16FNO — CID 62618338
3-(2,3-dihydroindol-1-yl)-1-(3-fluorophenyl)propan-1-one (PubChem CID 62618338) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-1-(3-fluorophenyl)propan-1-one.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-1-(3-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 62618338 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-1-(3-fluorophenyl)propan-1-one |
| SMILES | O=C(CCN1CCc2ccccc21)c1cccc(F)c1 |
| InChI | InChI=1S/C17H16FNO/c18-15-6-3-5-14(12-15)17(20)9-11-19-10-8-13-4-1-2-7-16(13)19/h1-7,12H,8-11H2 |
| InChIKey | XJHHWBZNDKXORP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |