C17H16BrFN2O — CID 110620208
3-bromo-N-[2-(2,3-dihydroindol-1-yl)ethyl]-5-fluorobenzamide (PubChem CID 110620208) has the molecular formula C17H16BrFN2O and a molecular weight of 363.23 g/mol. Its IUPAC name is 3-bromo-N-[2-(2,3-dihydroindol-1-yl)ethyl]-5-fluorobenzamide.
| Compound Name | 3-bromo-N-[2-(2,3-dihydroindol-1-yl)ethyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 110620208 |
| Molecular Formula | C17H16BrFN2O |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 3-bromo-N-[2-(2,3-dihydroindol-1-yl)ethyl]-5-fluorobenzamide |
| SMILES | O=C(NCCN1CCc2ccccc21)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C17H16BrFN2O/c18-14-9-13(10-15(19)11-14)17(22)20-6-8-21-7-5-12-3-1-2-4-16(12)21/h1-4,9-11H,5-8H2,(H,20,22) |
| InChIKey | RBROETZIFKPBJA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |