C21H20FN3O2 — CID 74248010
N-[3-(2,3-dihydroindol-1-yl)propyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 74248010) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 74248010 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc21)c1cc(=O)[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C21H20FN3O2/c22-15-6-7-16-17(13-20(26)24-18(16)12-15)21(27)23-9-3-10-25-11-8-14-4-1-2-5-19(14)25/h1-2,4-7,12-13H,3,8-11H2,(H,23,27)(H,24,26) |
| InChIKey | PDHHDOAXYOBMMN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|