C16H15BrFN — CID 62621612
2-[(2-bromo-5-fluorophenyl)methyl]-1,3-dihydroinden-2-amine (PubChem CID 62621612) has the molecular formula C16H15BrFN and a molecular weight of 320.21 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methyl]-1,3-dihydroinden-2-amine.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methyl]-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 62621612 |
| Molecular Formula | C16H15BrFN |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methyl]-1,3-dihydroinden-2-amine |
| SMILES | NC1(Cc2cc(F)ccc2Br)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H15BrFN/c17-15-6-5-14(18)7-13(15)10-16(19)8-11-3-1-2-4-12(11)9-16/h1-7H,8-10,19H2 |
| InChIKey | PFFSLAWHIBXRQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |