C15H21NO4 — CID 62626670
N-cyclopropyl-3-[2-ethoxy-6-(hydroxymethyl)phenoxy]propanamide (PubChem CID 62626670) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-cyclopropyl-3-[2-ethoxy-6-(hydroxymethyl)phenoxy]propanamide.
| Compound Name | N-cyclopropyl-3-[2-ethoxy-6-(hydroxymethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 62626670 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-cyclopropyl-3-[2-ethoxy-6-(hydroxymethyl)phenoxy]propanamide |
| SMILES | CCOc1cccc(CO)c1OCCC(=O)NC1CC1 |
| InChI | InChI=1S/C15H21NO4/c1-2-19-13-5-3-4-11(10-17)15(13)20-9-8-14(18)16-12-6-7-12/h3-5,12,17H,2,6-10H2,1H3,(H,16,18) |
| InChIKey | MVCLMBWSXQGXDK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |