C25H21NO4 — CID 626287
ethyl 2-benzoyl-3,4-diphenyl-2H-1,3-oxazole-5-carboxylate (PubChem CID 626287) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 2-benzoyl-3,4-diphenyl-2H-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-benzoyl-3,4-diphenyl-2H-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 626287 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | ethyl 2-benzoyl-3,4-diphenyl-2H-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N(c2ccccc2)C(C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C25H21NO4/c1-2-29-25(28)23-21(18-12-6-3-7-13-18)26(20-16-10-5-11-17-20)24(30-23)22(27)19-14-8-4-9-15-19/h3-17,24H,2H2,1H3 |
| InChIKey | AQVFYOREZFSIJC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |