C9H17N3O3 — CID 62637046
2-[(3-aminopyrrolidine-1-carbonyl)-methylamino]propanoic acid (PubChem CID 62637046) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[(3-aminopyrrolidine-1-carbonyl)-methylamino]propanoic acid.
| Compound Name | 2-[(3-aminopyrrolidine-1-carbonyl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62637046 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-[(3-aminopyrrolidine-1-carbonyl)-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)N1CCC(N)C1 |
| InChI | InChI=1S/C9H17N3O3/c1-6(8(13)14)11(2)9(15)12-4-3-7(10)5-12/h6-7H,3-5,10H2,1-2H3,(H,13,14) |
| InChIKey | MWNKYONOYGNKQY-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |