C13H23N3O3 — CID 79934908
2-[1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl(methyl)amino]propanoic acid (PubChem CID 79934908) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl(methyl)amino]propanoic acid.
| Compound Name | 2-[1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 79934908 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-[1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl(methyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H23N3O3/c1-10(12(17)18)14(2)13(19)16-8-7-15-6-4-3-5-11(15)9-16/h10-11H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | ZBKOTGUYUOFSDE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |