C13H15FN2S — CID 62647488
1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine (PubChem CID 62647488) has the molecular formula C13H15FN2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine.
| Compound Name | 1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 62647488 |
| Molecular Formula | C13H15FN2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1nc(-c2ccccc2F)cs1 |
| InChI | InChI=1S/C13H15FN2S/c1-2-9(15)7-13-16-12(8-17-13)10-5-3-4-6-11(10)14/h3-6,8-9H,2,7,15H2,1H3 |
| InChIKey | XZJLPHMUNPUAFC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |