C15H13Cl2FN2O — CID 62649355
N-(2,6-dichloro-3-methylphenyl)-3-fluoro-2-(methylamino)benzamide (PubChem CID 62649355) has the molecular formula C15H13Cl2FN2O and a molecular weight of 327.19 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methylphenyl)-3-fluoro-2-(methylamino)benzamide.
| Compound Name | N-(2,6-dichloro-3-methylphenyl)-3-fluoro-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 62649355 |
| Molecular Formula | C15H13Cl2FN2O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(2,6-dichloro-3-methylphenyl)-3-fluoro-2-(methylamino)benzamide |
| SMILES | CNc1c(F)cccc1C(=O)Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C15H13Cl2FN2O/c1-8-6-7-10(16)14(12(8)17)20-15(21)9-4-3-5-11(18)13(9)19-2/h3-7,19H,1-2H3,(H,20,21) |
| InChIKey | XKLIWDWCQVYYNK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |