C14H11F3N2O — CID 62650098
N-(3,5-difluorophenyl)-3-fluoro-2-(methylamino)benzamide (PubChem CID 62650098) has the molecular formula C14H11F3N2O and a molecular weight of 280.25 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-fluoro-2-(methylamino)benzamide.
| Compound Name | N-(3,5-difluorophenyl)-3-fluoro-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 62650098 |
| Molecular Formula | C14H11F3N2O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-fluoro-2-(methylamino)benzamide |
| SMILES | CNc1c(F)cccc1C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11F3N2O/c1-18-13-11(3-2-4-12(13)17)14(20)19-10-6-8(15)5-9(16)7-10/h2-7,18H,1H3,(H,19,20) |
| InChIKey | GPLBUPDGXCQPDY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |