C26H28N2O3 — CID 626541
6-methoxy-12-phenacyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-17-one (PubChem CID 626541) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 6-methoxy-12-phenacyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-17-one.
| Compound Name | 6-methoxy-12-phenacyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-17-one |
|---|---|
| PubChem CID | 626541 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 6-methoxy-12-phenacyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-17-one |
| SMILES | COc1cccc2c1NC1CCC3(CC(=O)c4ccccc4)CCCN4C(=O)CC21C43 |
| InChI | InChI=1S/C26H28N2O3/c1-31-20-10-5-9-18-23(20)27-21-11-13-25(15-19(29)17-7-3-2-4-8-17)12-6-14-28-22(30)16-26(18,21)24(25)28/h2-5,7-10,21,24,27H,6,11-16H2,1H3 |
| InChIKey | CPZRZFGLHHXCFU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |