C15H23N3O3 — CID 62654573
N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(3-formylpiperidin-1-yl)acetamide (PubChem CID 62654573) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(3-formylpiperidin-1-yl)acetamide.
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(3-formylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 62654573 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(3-formylpiperidin-1-yl)acetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CN2CCCC(C=O)C2)on1 |
| InChI | InChI=1S/C15H23N3O3/c1-15(2,3)12-7-14(21-17-12)16-13(20)9-18-6-4-5-11(8-18)10-19/h7,10-11H,4-6,8-9H2,1-3H3,(H,16,20) |
| InChIKey | RGZOCMFTBDIKQV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|