C14H15Br3N2O2 — CID 62660463
2-(3-formylpiperidin-1-yl)-N-(2,4,6-tribromophenyl)acetamide (PubChem CID 62660463) has the molecular formula C14H15Br3N2O2 and a molecular weight of 483.00 g/mol. Its IUPAC name is 2-(3-formylpiperidin-1-yl)-N-(2,4,6-tribromophenyl)acetamide.
| Compound Name | 2-(3-formylpiperidin-1-yl)-N-(2,4,6-tribromophenyl)acetamide |
|---|---|
| PubChem CID | 62660463 |
| Molecular Formula | C14H15Br3N2O2 |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 479.87 |
| IUPAC Name | 2-(3-formylpiperidin-1-yl)-N-(2,4,6-tribromophenyl)acetamide |
| SMILES | O=CC1CCCN(CC(=O)Nc2c(Br)cc(Br)cc2Br)C1 |
| InChI | InChI=1S/C14H15Br3N2O2/c15-10-4-11(16)14(12(17)5-10)18-13(21)7-19-3-1-2-9(6-19)8-20/h4-5,8-9H,1-3,6-7H2,(H,18,21) |
| InChIKey | FGKPONJCLHRVGU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|