C16H19N3O2 — CID 62655496
1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carbaldehyde (PubChem CID 62655496) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carbaldehyde.
| Compound Name | 1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 62655496 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carbaldehyde |
| SMILES | Cc1ccc(-c2nc(CN3CCCC(C=O)C3)no2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-4-6-14(7-5-12)16-17-15(18-21-16)10-19-8-2-3-13(9-19)11-20/h4-7,11,13H,2-3,8-10H2,1H3 |
| InChIKey | NEGBMGFOAVQGGL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|