C22H24N4O3 — CID 92733328
(3R)-N-(4-hydroxyphenyl)-1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 92733328) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is (3R)-N-(4-hydroxyphenyl)-1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-hydroxyphenyl)-1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92733328 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (3R)-N-(4-hydroxyphenyl)-1-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(-c2nc(CN3CCC[C@@H](C(=O)Nc4ccc(O)cc4)C3)no2)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-15-4-6-16(7-5-15)22-24-20(25-29-22)14-26-12-2-3-17(13-26)21(28)23-18-8-10-19(27)11-9-18/h4-11,17,27H,2-3,12-14H2,1H3,(H,23,28)/t17-/m1/s1 |
| InChIKey | RDUQYHWVTPUAQO-QGZVFWFLSA-N |
| XLogP | 3.60 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|