C21H21FN4O3 — CID 50814431
1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 50814431) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50814431 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCN(Cc2noc(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C21H21FN4O3/c22-16-3-1-15(2-4-16)21-24-19(25-29-21)13-26-11-9-14(10-12-26)20(28)23-17-5-7-18(27)8-6-17/h1-8,14,27H,9-13H2,(H,23,28) |
| InChIKey | ZJWGZMBFXBLLIA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|