C13H17N3O2S — CID 62664800
1-(4-cyanophenyl)-N-[2-(cyclopropylamino)ethyl]methanesulfonamide (PubChem CID 62664800) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-N-[2-(cyclopropylamino)ethyl]methanesulfonamide.
| Compound Name | 1-(4-cyanophenyl)-N-[2-(cyclopropylamino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 62664800 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(4-cyanophenyl)-N-[2-(cyclopropylamino)ethyl]methanesulfonamide |
| SMILES | N#Cc1ccc(CS(=O)(=O)NCCNC2CC2)cc1 |
| InChI | InChI=1S/C13H17N3O2S/c14-9-11-1-3-12(4-2-11)10-19(17,18)16-8-7-15-13-5-6-13/h1-4,13,15-16H,5-8,10H2 |
| InChIKey | REHFWOJTEWOPLD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|