C16H20N2O2S — CID 60697689
1-(4-cyanophenyl)-N-[2-(cyclohexen-1-yl)ethyl]methanesulfonamide (PubChem CID 60697689) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-N-[2-(cyclohexen-1-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(4-cyanophenyl)-N-[2-(cyclohexen-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 60697689 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(4-cyanophenyl)-N-[2-(cyclohexen-1-yl)ethyl]methanesulfonamide |
| SMILES | N#Cc1ccc(CS(=O)(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C16H20N2O2S/c17-12-15-6-8-16(9-7-15)13-21(19,20)18-11-10-14-4-2-1-3-5-14/h4,6-9,18H,1-3,5,10-11,13H2 |
| InChIKey | ZPOBCQXPKDGLNC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|