C11H21N3O3S — CID 62672633
N-(1,1-dioxothiolan-3-yl)-2-(2-methylpiperazin-1-yl)acetamide (PubChem CID 62672633) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 62672633 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methylpiperazin-1-yl)acetamide |
| SMILES | CC1CNCCN1CC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21N3O3S/c1-9-6-12-3-4-14(9)7-11(15)13-10-2-5-18(16,17)8-10/h9-10,12H,2-8H2,1H3,(H,13,15) |
| InChIKey | PTXCTUMTCJJONZ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |