C9H14N2O4S — CID 62675008
2-methyl-3-[(1-methylpyrrol-3-yl)sulfonylamino]propanoic acid (PubChem CID 62675008) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-methyl-3-[(1-methylpyrrol-3-yl)sulfonylamino]propanoic acid.
| Compound Name | 2-methyl-3-[(1-methylpyrrol-3-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 62675008 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-methyl-3-[(1-methylpyrrol-3-yl)sulfonylamino]propanoic acid |
| SMILES | CC(CNS(=O)(=O)c1ccn(C)c1)C(=O)O |
| InChI | InChI=1S/C9H14N2O4S/c1-7(9(12)13)5-10-16(14,15)8-3-4-11(2)6-8/h3-4,6-7,10H,5H2,1-2H3,(H,12,13) |
| InChIKey | GCVZUIZDBIPIDB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |