C12H20N2O4S — CID 113308523
2-ethyl-2-[[(1-methylpyrrol-3-yl)sulfonylamino]methyl]butanoic acid (PubChem CID 113308523) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-ethyl-2-[[(1-methylpyrrol-3-yl)sulfonylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[(1-methylpyrrol-3-yl)sulfonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 113308523 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-ethyl-2-[[(1-methylpyrrol-3-yl)sulfonylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNS(=O)(=O)c1ccn(C)c1)C(=O)O |
| InChI | InChI=1S/C12H20N2O4S/c1-4-12(5-2,11(15)16)9-13-19(17,18)10-6-7-14(3)8-10/h6-8,13H,4-5,9H2,1-3H3,(H,15,16) |
| InChIKey | SGDQCVLEYWAEGF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |