C14H19NO4 — CID 62676386
2-methyl-3-(2-phenoxybutanoylamino)propanoic acid (PubChem CID 62676386) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-methyl-3-(2-phenoxybutanoylamino)propanoic acid.
| Compound Name | 2-methyl-3-(2-phenoxybutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 62676386 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-methyl-3-(2-phenoxybutanoylamino)propanoic acid |
| SMILES | CCC(Oc1ccccc1)C(=O)NCC(C)C(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-3-12(19-11-7-5-4-6-8-11)13(16)15-9-10(2)14(17)18/h4-8,10,12H,3,9H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | SFZKUZZPXMSGKH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |