C11H15NO3S — CID 62678012
5-(2,2-dimethylbutanoylamino)thiophene-2-carboxylic acid (PubChem CID 62678012) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 5-(2,2-dimethylbutanoylamino)thiophene-2-carboxylic acid.
| Compound Name | 5-(2,2-dimethylbutanoylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 62678012 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 5-(2,2-dimethylbutanoylamino)thiophene-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C11H15NO3S/c1-4-11(2,3)10(15)12-8-6-5-7(16-8)9(13)14/h5-6H,4H2,1-3H3,(H,12,15)(H,13,14) |
| InChIKey | JMIFBJGVRBCCKF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |