C13H13N5OS — CID 62683421
N-[4-[(3-carbamothioylpyrazin-2-yl)amino]phenyl]acetamide (PubChem CID 62683421) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[4-[(3-carbamothioylpyrazin-2-yl)amino]phenyl]acetamide.
| Compound Name | N-[4-[(3-carbamothioylpyrazin-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 62683421 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[4-[(3-carbamothioylpyrazin-2-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nccnc2C(N)=S)cc1 |
| InChI | InChI=1S/C13H13N5OS/c1-8(19)17-9-2-4-10(5-3-9)18-13-11(12(14)20)15-6-7-16-13/h2-7H,1H3,(H2,14,20)(H,16,18)(H,17,19) |
| InChIKey | ZBTPDCVNQNDKMX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|