C12H15N5S — CID 62684545
3-[ethyl(thiophen-2-ylmethyl)amino]pyrazine-2-carboximidamide (PubChem CID 62684545) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-[ethyl(thiophen-2-ylmethyl)amino]pyrazine-2-carboximidamide.
| Compound Name | 3-[ethyl(thiophen-2-ylmethyl)amino]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 62684545 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[ethyl(thiophen-2-ylmethyl)amino]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccnc1N(CC)Cc1cccs1 |
| InChI | InChI=1S/C12H15N5S/c1-2-17(8-9-4-3-7-18-9)12-10(11(13)14)15-5-6-16-12/h3-7H,2,8H2,1H3,(H3,13,14) |
| InChIKey | OKQHRKNIEGAZKO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|