C14H16FN3S — CID 63668141
2-[ethyl(thiophen-2-ylmethyl)amino]-5-fluorobenzenecarboximidamide (PubChem CID 63668141) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[ethyl(thiophen-2-ylmethyl)amino]-5-fluorobenzenecarboximidamide.
| Compound Name | 2-[ethyl(thiophen-2-ylmethyl)amino]-5-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 63668141 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[ethyl(thiophen-2-ylmethyl)amino]-5-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1N(CC)Cc1cccs1 |
| InChI | InChI=1S/C14H16FN3S/c1-2-18(9-11-4-3-7-19-11)13-6-5-10(15)8-12(13)14(16)17/h3-8H,2,9H2,1H3,(H3,16,17) |
| InChIKey | UADAGHDWKUYGTP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|