C13H20ClN3O — CID 62688638
2-[2-aminoethyl(methyl)amino]-N-[(3-chlorophenyl)methyl]-N-methylacetamide (PubChem CID 62688638) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-[(3-chlorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-[(3-chlorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 62688638 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-[(3-chlorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(CCN)CC(=O)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H20ClN3O/c1-16(7-6-15)10-13(18)17(2)9-11-4-3-5-12(14)8-11/h3-5,8H,6-7,9-10,15H2,1-2H3 |
| InChIKey | WCPXCVCCAOFYAN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |