C16H23ClN2O2 — CID 102677225
N-[(3-chlorophenyl)methyl]-2-[cyclobutyl(2-hydroxyethyl)amino]-N-methylacetamide (PubChem CID 102677225) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[cyclobutyl(2-hydroxyethyl)amino]-N-methylacetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[cyclobutyl(2-hydroxyethyl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 102677225 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[cyclobutyl(2-hydroxyethyl)amino]-N-methylacetamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)CN(CCO)C1CCC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-18(11-13-4-2-5-14(17)10-13)16(21)12-19(8-9-20)15-6-3-7-15/h2,4-5,10,15,20H,3,6-9,11-12H2,1H3 |
| InChIKey | GFQFHVUWFJRCJF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |