C11H14N4O — CID 62694256
4-[2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethyl]phenol (PubChem CID 62694256) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-[2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethyl]phenol.
| Compound Name | 4-[2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethyl]phenol |
|---|---|
| PubChem CID | 62694256 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-[2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethyl]phenol |
| SMILES | Cn1cnnc1C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N4O/c1-15-7-13-14-11(15)10(12)6-8-2-4-9(16)5-3-8/h2-5,7,10,16H,6,12H2,1H3 |
| InChIKey | DAFJTAWLLRUGJV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |