C12H22N2OS — CID 62694585
1-carbamothioyl-N-(2-methylbutyl)cyclopentane-1-carboxamide (PubChem CID 62694585) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2-methylbutyl)cyclopentane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2-methylbutyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 62694585 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-carbamothioyl-N-(2-methylbutyl)cyclopentane-1-carboxamide |
| SMILES | CCC(C)CNC(=O)C1(C(N)=S)CCCC1 |
| InChI | InChI=1S/C12H22N2OS/c1-3-9(2)8-14-11(15)12(10(13)16)6-4-5-7-12/h9H,3-8H2,1-2H3,(H2,13,16)(H,14,15) |
| InChIKey | UTACJTLQALUYBC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|