C14H22N2OS — CID 80590816
1-carbamothioyl-N-(2,2-dicyclopropylethyl)cyclobutane-1-carboxamide (PubChem CID 80590816) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,2-dicyclopropylethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,2-dicyclopropylethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80590816 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-carbamothioyl-N-(2,2-dicyclopropylethyl)cyclobutane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)NCC(C2CC2)C2CC2)CCC1 |
| InChI | InChI=1S/C14H22N2OS/c15-12(18)14(6-1-7-14)13(17)16-8-11(9-2-3-9)10-4-5-10/h9-11H,1-8H2,(H2,15,18)(H,16,17) |
| InChIKey | RTVGQPFRRZSLBT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|