C13H16N4O — CID 62696230
2-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]ethanol (PubChem CID 62696230) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]ethanol.
| Compound Name | 2-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]ethanol |
|---|---|
| PubChem CID | 62696230 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)anilino]ethanol |
| SMILES | OCCNc1ccc(-c2nncn2C2CC2)cc1 |
| InChI | InChI=1S/C13H16N4O/c18-8-7-14-11-3-1-10(2-4-11)13-16-15-9-17(13)12-5-6-12/h1-4,9,12,14,18H,5-8H2 |
| InChIKey | OJCHYGXTPZHCGS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |